CAS 1955523-48-4 is the registry number for 6-Hydroxy-2-(oxan-4-ylidene)-2,3-dihydro-1-benzofuran-3-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-hydroxy-2-(oxan-4-ylidene)-1-benzofuran-3-one (CAS 1955523-48-4) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 6-hydroxy-2-(oxan-4-ylidene)-1-benzofuran-3-one. InChIKey: QAYXRCVLWHXECE-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 6-hydroxy-2-(oxan-4-ylidene)-1-benzofuran-3-one |
| InChIKey | QAYXRCVLWHXECE-UHFFFAOYSA-N |
| SMILES | C1COCCC1=C2C(=O)C3=C(O2)C=C(C=C3)O |
Computed by PubChem (NCBI)