CAS 90381-45-6 is the registry number for 4,7-Dimethoxy-1-naphthoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4,7-dimethoxynaphthalene-1-carboxylic acid (CAS 90381-45-6) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 4,7-dimethoxynaphthalene-1-carboxylic acid. InChIKey: PCBJZCAKNURVSK-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 4,7-dimethoxynaphthalene-1-carboxylic acid |
| InChIKey | PCBJZCAKNURVSK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC(=C2C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)