Products 6843-89-6

CAS 6843-89-6 appears in our catalog under these names: 1,3-Dihydroxy-2-naphthalenecarboxylic acid ethyl ester, 95%, Ethyl 1,3–Dihydroxy–2–naphthoate, Ethyl 1,3-Dihydroxy-2-naphthoate, 98+%, 98+%, 1,3-Dihydroxy-2-naphthalenecarboxylic acid ethyl ester, >95%, Ethyl 1,3-dihydroxy-2-naphthoate, 98+%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 1,3-dihydroxynaphthalene-2-carboxylate (CAS 6843-89-6) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: ethyl 1,3-dihydroxynaphthalene-2-carboxylate. InChIKey: JNVQTZHEEIATCI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O4
Molecular weight232.23 g/mol
IUPAC nameethyl 1,3-dihydroxynaphthalene-2-carboxylate
InChIKeyJNVQTZHEEIATCI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C2=CC=CC=C2C=C1O)O

Computed by PubChem (NCBI)