CAS 1341038-75-2 appears in our catalog under these names: RAcemic–(1R,2S)–Ethyl 2–Oxospiro(Cyclopropane–1,3–Indoline)–2–Carboxylate, Racemic-(1r,2s)-ethyl 2'-oxospiro[cyclopropane-1,3'-indoline]-2-carboxylate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 5g, 1g.
Ethyl (1'S,3R)-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate (CAS 1341038-75-2) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl (1'S,3R)-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate. InChIKey: YWDXJHCEEUYKQN-RNCFNFMXSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | ethyl (1'S,3R)-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate |
| InChIKey | YWDXJHCEEUYKQN-RNCFNFMXSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@]12C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)