CAS 1483268-46-7 appears in our catalog under these names: 2-(2,4-Dichlorophenyl)-2-methoxyacetonitrile, 98%, 2-(2,4-Dichlorophenyl)-2-methoxyacetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(2,4-dichlorophenyl)-2-methoxyacetonitrile (CAS 1483268-46-7) is a chemical compound with the molecular formula C9H7Cl2NO and a molecular weight of 216.06 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2-methoxyacetonitrile. InChIKey: ACFRVNZCWLOTAW-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2-methoxyacetonitrile |
| InChIKey | ACFRVNZCWLOTAW-UHFFFAOYSA-N |
| SMILES | COC(C#N)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)