CAS 134151-77-2 appears in our catalog under these names: 1-Bromo-4-(trifluorovinyloxy)benzene, 95%, 1-Bromo-4-(trifluorovinyloxy)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
1-bromo-4-(1,2,2-trifluoroethenoxy)benzene (CAS 134151-77-2) is a chemical compound with the molecular formula C8H4BrF3O and a molecular weight of 253.02 g/mol. IUPAC name: 1-bromo-4-(1,2,2-trifluoroethenoxy)benzene. InChIKey: KGNLXBIRBHMRHB-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O |
|---|---|
| Molecular weight | 253.02 g/mol |
| IUPAC name | 1-bromo-4-(1,2,2-trifluoroethenoxy)benzene |
| InChIKey | KGNLXBIRBHMRHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(=C(F)F)F)Br |
Computed by PubChem (NCBI)