CAS 655-26-5 appears in our catalog under these names: 3′-Bromo-2,2,2-trifluoroacetophenone 99%, 3'-BROMO-2,2,2-TRIFLUOROACETOPHENONE, Ethanone, 1-(3-bromophenyl)-2,2,2-trifluoro-, 99%, 99%, 3'-Bromo-2,2,2-trifluoroacetophenone, 97%. Offered by: Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 10g.
1-(3-bromophenyl)-2,2,2-trifluoroethanone (CAS 655-26-5) is a chemical compound with the molecular formula C8H4BrF3O and a molecular weight of 253.02 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2,2-trifluoroethanone. InChIKey: JOKNUXPHMQZTQB-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O |
|---|---|
| Molecular weight | 253.02 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2,2-trifluoroethanone |
| InChIKey | JOKNUXPHMQZTQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)