CAS 1896891-81-8 is the registry number for 1-(3-Bromo-2,4,5-trifluorophenyl)ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-(3-bromo-2,4,5-trifluorophenyl)ethanone (CAS 1896891-81-8) is a chemical compound with the molecular formula C8H4BrF3O and a molecular weight of 253.02 g/mol. IUPAC name: 1-(3-bromo-2,4,5-trifluorophenyl)ethanone. InChIKey: NBDLIZOSQSAVAL-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O |
|---|---|
| Molecular weight | 253.02 g/mol |
| IUPAC name | 1-(3-bromo-2,4,5-trifluorophenyl)ethanone |
| InChIKey | NBDLIZOSQSAVAL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1F)Br)F)F |
Computed by PubChem (NCBI)