Products 1341562-07-9
CAS 1341562-07-9 is the registry number for 2-Amino-3,3,3-trifluoro-2-(3-fluorophenyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-3,3,3-trifluoro-2-(3-fluorophenyl)propanoic acid (CAS 1341562-07-9) is a chemical compound with the molecular formula C9H7F4NO2 and a molecular weight of 237.15 g/mol. IUPAC name: 2-amino-3,3,3-trifluoro-2-(3-fluorophenyl)propanoic acid. InChIKey: NUXDDYNJOVNZHY-UHFFFAOYSA-N.
| Molecular formula | C9H7F4NO2 |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | 2-amino-3,3,3-trifluoro-2-(3-fluorophenyl)propanoic acid |
| InChIKey | NUXDDYNJOVNZHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C(=O)O)(C(F)(F)F)N |
Computed by PubChem (NCBI)