CAS 1341567-52-9 is the registry number for 3-(4-Bromophenyl)-1,2,4-oxadiazole-5-thiol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(4-bromophenyl)-2H-1,2,4-oxadiazole-5-thione (CAS 1341567-52-9) is a chemical compound with the molecular formula C8H5BrN2OS and a molecular weight of 257.11 g/mol. IUPAC name: 3-(4-bromophenyl)-2H-1,2,4-oxadiazole-5-thione. InChIKey: WKMNOVCSPUZASJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2OS |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 3-(4-bromophenyl)-2H-1,2,4-oxadiazole-5-thione |
| InChIKey | WKMNOVCSPUZASJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=S)ON2)Br |
Computed by PubChem (NCBI)