Products 1594520-35-0
CAS 1594520-35-0 is the registry number for 8-Bromo-2-mercaptoquinazolin-4(3h)-one, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 100mg.
8-bromo-2-sulfanylidene-1H-quinazolin-4-one (CAS 1594520-35-0) is a chemical compound with the molecular formula C8H5BrN2OS and a molecular weight of 257.11 g/mol. IUPAC name: 8-bromo-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: VLJDHVXBKWJTRP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2OS |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 8-bromo-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | VLJDHVXBKWJTRP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=S)NC2=O |
Computed by PubChem (NCBI)