CAS 1343249-15-9 appears in our catalog under these names: 4-(5-Bromo-1,3,4-thiadiazol-2-yl)phenol, 95%, 4-(5-Bromo-1,3,4-thiadiazol-2-yl)phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(5-bromo-1,3,4-thiadiazol-2-yl)phenol (CAS 1343249-15-9) is a chemical compound with the molecular formula C8H5BrN2OS and a molecular weight of 257.11 g/mol. IUPAC name: 4-(5-bromo-1,3,4-thiadiazol-2-yl)phenol. InChIKey: UCOHTXUDPYYVQF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2OS |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 4-(5-bromo-1,3,4-thiadiazol-2-yl)phenol |
| InChIKey | UCOHTXUDPYYVQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)Br)O |
Computed by PubChem (NCBI)