CAS 41421-19-6 appears in our catalog under these names: 5-(4-Bromophenyl)-1,3,4-oxadiazole-2-thiol, 98%, 5-(4-Bromophenyl)-1,3,4-oxadiazole-2(3H)-thione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
5-(4-bromophenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 41421-19-6) is a chemical compound with the molecular formula C8H5BrN2OS and a molecular weight of 257.11 g/mol. IUPAC name: 5-(4-bromophenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: IAUFUSRGSRXPQY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2OS |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | IAUFUSRGSRXPQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)O2)Br |
Computed by PubChem (NCBI)