Products 1341824-98-3
CAS 1341824-98-3 is the registry number for 3-(Cyclopropyl(methyl)amino)-4,4,4-trifluorobutanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[cyclopropyl(methyl)amino]-4,4,4-trifluorobutanoic acid (CAS 1341824-98-3) is a chemical compound with the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. IUPAC name: 3-[cyclopropyl(methyl)amino]-4,4,4-trifluorobutanoic acid. InChIKey: CKXAYTDMSFZWEN-UHFFFAOYSA-N.
| Molecular formula | C8H12F3NO2 |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | 3-[cyclopropyl(methyl)amino]-4,4,4-trifluorobutanoic acid |
| InChIKey | CKXAYTDMSFZWEN-UHFFFAOYSA-N |
| SMILES | CN(C1CC1)C(CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)