Products 1341862-89-2
CAS 1341862-89-2 appears in our catalog under these names: 2-Cyclopentylpyrimidine-4-carboxylic acid, 2-Cyclopentylpyrimidine-4-carboxylic acid, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-cyclopentylpyrimidine-4-carboxylic acid (CAS 1341862-89-2) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 2-cyclopentylpyrimidine-4-carboxylic acid. InChIKey: DAICBHAXXNOKAT-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2-cyclopentylpyrimidine-4-carboxylic acid |
| InChIKey | DAICBHAXXNOKAT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)