Products 1341872-13-6
CAS 1341872-13-6 is the registry number for 6-Chloro-2-(2-methylpropoxy)-3-pyridinecarboxylic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
6-chloro-2-(2-methylpropoxy)pyridine-3-carboxylic acid (CAS 1341872-13-6) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: 6-chloro-2-(2-methylpropoxy)pyridine-3-carboxylic acid. InChIKey: RKUCVOVYEQWGSJ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 6-chloro-2-(2-methylpropoxy)pyridine-3-carboxylic acid |
| InChIKey | RKUCVOVYEQWGSJ-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=CC(=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)