CAS 1342121-06-5 appears in our catalog under these names: 4-(5-Ethyl-1,3,4-oxadiazol-2-yl)benzoic acid, 95%, 4-(5-Ethyl-1,3,4-oxadiazol-2-yl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-(5-ethyl-1,3,4-oxadiazol-2-yl)benzoic acid (CAS 1342121-06-5) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 4-(5-ethyl-1,3,4-oxadiazol-2-yl)benzoic acid. InChIKey: ZYUQQQQHBBWZGY-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 4-(5-ethyl-1,3,4-oxadiazol-2-yl)benzoic acid |
| InChIKey | ZYUQQQQHBBWZGY-UHFFFAOYSA-N |
| SMILES | CCC1=NN=C(O1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)