CAS 1342218-33-0 appears in our catalog under these names: 1-(4-Ethyl-1,3-thiazol-2-yl)-1H-pyrazole-4-carboxylic acid, 95%, 1-(4-Ethyl-1,3-thiazol-2-yl)-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(4-ethyl-1,3-thiazol-2-yl)pyrazole-4-carboxylic acid (CAS 1342218-33-0) is a chemical compound with the molecular formula C9H9N3O2S and a molecular weight of 223.25 g/mol. IUPAC name: 1-(4-ethyl-1,3-thiazol-2-yl)pyrazole-4-carboxylic acid. InChIKey: HOKWDDKSUNRVSE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 1-(4-ethyl-1,3-thiazol-2-yl)pyrazole-4-carboxylic acid |
| InChIKey | HOKWDDKSUNRVSE-UHFFFAOYSA-N |
| SMILES | CCC1=CSC(=N1)N2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)