CAS 1342311-77-6 is the registry number for [(1S)-1-phenylbutyl]amine hydrochloride. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S)-1-phenylbutan-1-amine;hydrochloride (CAS 1342311-77-6) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1S)-1-phenylbutan-1-amine;hydrochloride. InChIKey: SRLJBKBDJRRHGL-PPHPATTJSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1S)-1-phenylbutan-1-amine;hydrochloride |
| InChIKey | SRLJBKBDJRRHGL-PPHPATTJSA-N |
| SMILES | CCC[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)