CAS 1342397-22-1 is the registry number for 1-(1-Bromo-2,2,2-trifluoroethyl)-2,4-dichlorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(1-bromo-2,2,2-trifluoroethyl)-2,4-dichlorobenzene (CAS 1342397-22-1) is a chemical compound with the molecular formula C8H4BrCl2F3 and a molecular weight of 307.92 g/mol. IUPAC name: 1-(1-bromo-2,2,2-trifluoroethyl)-2,4-dichlorobenzene. InChIKey: ILFSFIKPDBLFKK-UHFFFAOYSA-N.
| Molecular formula | C8H4BrCl2F3 |
|---|---|
| Molecular weight | 307.92 g/mol |
| IUPAC name | 1-(1-bromo-2,2,2-trifluoroethyl)-2,4-dichlorobenzene |
| InChIKey | ILFSFIKPDBLFKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(C(F)(F)F)Br |
Computed by PubChem (NCBI)