Products 886501-99-1
CAS 886501-99-1 appears in our catalog under these names: 2,3-Dichloro-6-(trifluoromethyl)benzyl bromide, 95%, 2-(Bromomethyl)-3,4-dichloro-1-(trifluoromethyl)benzene 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-(bromomethyl)-1,2-dichloro-4-(trifluoromethyl)benzene (CAS 886501-99-1) is a chemical compound with the molecular formula C8H4BrCl2F3 and a molecular weight of 307.92 g/mol. IUPAC name: 3-(bromomethyl)-1,2-dichloro-4-(trifluoromethyl)benzene. InChIKey: BTXOBZONYMZJCP-UHFFFAOYSA-N.
| Molecular formula | C8H4BrCl2F3 |
|---|---|
| Molecular weight | 307.92 g/mol |
| IUPAC name | 3-(bromomethyl)-1,2-dichloro-4-(trifluoromethyl)benzene |
| InChIKey | BTXOBZONYMZJCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)CBr)Cl)Cl |
Computed by PubChem (NCBI)