Products 865354-19-4
CAS 865354-19-4 is the registry number for 1-Bromo-3-(dichloromethyl)-5-(trifluoromethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3-(dichloromethyl)-5-(trifluoromethyl)benzene (CAS 865354-19-4) is a chemical compound with the molecular formula C8H4BrCl2F3 and a molecular weight of 307.92 g/mol. IUPAC name: 1-bromo-3-(dichloromethyl)-5-(trifluoromethyl)benzene. InChIKey: HCKCBJKIZLUFTL-UHFFFAOYSA-N.
| Molecular formula | C8H4BrCl2F3 |
|---|---|
| Molecular weight | 307.92 g/mol |
| IUPAC name | 1-bromo-3-(dichloromethyl)-5-(trifluoromethyl)benzene |
| InChIKey | HCKCBJKIZLUFTL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Br)C(Cl)Cl |
Computed by PubChem (NCBI)