Products 1823323-67-6
CAS 1823323-67-6 appears in our catalog under these names: 3,4-Dichloro-5-(trifluoromethyl)benzyl bromide, 95%, 3,4-Dichloro-5-(trifluoromethyl)benzyl bromide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-(bromomethyl)-1,2-dichloro-3-(trifluoromethyl)benzene (CAS 1823323-67-6) is a chemical compound with the molecular formula C8H4BrCl2F3 and a molecular weight of 307.92 g/mol. IUPAC name: 5-(bromomethyl)-1,2-dichloro-3-(trifluoromethyl)benzene. InChIKey: NTYHLYVDLXQFAO-UHFFFAOYSA-N.
| Molecular formula | C8H4BrCl2F3 |
|---|---|
| Molecular weight | 307.92 g/mol |
| IUPAC name | 5-(bromomethyl)-1,2-dichloro-3-(trifluoromethyl)benzene |
| InChIKey | NTYHLYVDLXQFAO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)CBr |
Computed by PubChem (NCBI)