CAS 1342547-91-4 appears in our catalog under these names: 5,5-Dimethyl-4,5,6,7-tetrahydro-2h-indazole-3-carboxylic acid, 95%, 5,5-Dimethyl-4,5,6,7-tetrahydro-1h-indazole-3-carboxylic acid, 95%, 5,5-Dimethyl-4,5,6,7-tetrahydro-2H-indazole-3-carboxylic acid, 98%, 5,5-Dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,5g.
5,5-dimethyl-1,4,6,7-tetrahydroindazole-3-carboxylic acid (CAS 1342547-91-4) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 5,5-dimethyl-1,4,6,7-tetrahydroindazole-3-carboxylic acid. InChIKey: ISMDTJILBJJLPA-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5,5-dimethyl-1,4,6,7-tetrahydroindazole-3-carboxylic acid |
| InChIKey | ISMDTJILBJJLPA-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1)C(=NN2)C(=O)O)C |
Computed by PubChem (NCBI)