CAS 1342707-37-2 appears in our catalog under these names: Ethyl 2–amino–3–bromobenzoate, Ethyl 2-amino-3-bromobenzoate, 95%, Ethyl 2-amino-3-bromobenzoate, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g.
Ethyl 2-amino-3-bromobenzoate (CAS 1342707-37-2) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: ethyl 2-amino-3-bromobenzoate. InChIKey: MSSHUVIRFCGOPM-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | ethyl 2-amino-3-bromobenzoate |
| InChIKey | MSSHUVIRFCGOPM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)Br)N |
Computed by PubChem (NCBI)