CAS 134302-12-8 appears in our catalog under these names: 5-Cyclopentanecarbonyl-2,2-dimethyl-1,3-dioxane-4,6-dione, 95%, 5-Cyclopentanecarbonyl-2,2-dimethyl-1,3-dioxane-4,6-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-(cyclopentanecarbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 134302-12-8) is a chemical compound with the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. IUPAC name: 5-(cyclopentanecarbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: MIDXSBJOWHMRQD-UHFFFAOYSA-N.
| Molecular formula | C12H16O5 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 5-(cyclopentanecarbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | MIDXSBJOWHMRQD-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)C(=O)C2CCCC2)C |
Computed by PubChem (NCBI)