Products 1343062-15-6

CAS 1343062-15-6 appears in our catalog under these names: 2,7-Dioxaspiro(4.4)nonane-1,3-dione, 95%, 2,7-Dioxaspiro(4.4)nonane-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,7-dioxaspiro[4.4]nonane-1,3-dione (CAS 1343062-15-6) is a chemical compound with the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. IUPAC name: 2,7-dioxaspiro[4.4]nonane-1,3-dione. InChIKey: SVAOMOXYUFPORO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O4
Molecular weight156.14 g/mol
IUPAC name2,7-dioxaspiro[4.4]nonane-1,3-dione
InChIKeySVAOMOXYUFPORO-UHFFFAOYSA-N
SMILESC1COCC12CC(=O)OC2=O

Computed by PubChem (NCBI)