Products 3505-67-7

CAS 3505-67-7 appears in our catalog under these names: 1,6-Dioxaspiro[4.4]nonane-2,7-dione, 95%, 1,6-Dioxaspiro[4.4]nonane-2,7-dione 95%, 1,6-DIOXASPIRO(4.4)NONANE-2,7-DIONE, 98%, 1,6-Dioxaspiro[4.4]nonane-2,7-dione, 95%, 95%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 1g, 10g, 25g, 100g.

1,6-dioxaspiro[4.4]nonane-2,7-dione (CAS 3505-67-7) is a chemical compound with the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. IUPAC name: 1,6-dioxaspiro[4.4]nonane-2,7-dione. InChIKey: VTQYOGUFKHVWOO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O4
Molecular weight156.14 g/mol
IUPAC name1,6-dioxaspiro[4.4]nonane-2,7-dione
InChIKeyVTQYOGUFKHVWOO-UHFFFAOYSA-N
SMILESC1CC2(CCC(=O)O2)OC1=O

Computed by PubChem (NCBI)