Products 56842-95-6
CAS 56842-95-6 appears in our catalog under these names: Bicyclo[1.1.1]pentane-1,3-dicarboxylic acid 95%, Bicyclo[1.1.1]pentane-1,3-dicarboxylic acid, 95%, Bicyclo(1·1·1)pentane–1，3–dicarboxylic acid, Bicyclo[1.1.1]pentane-1,3-dicarboxylic Acid, >98.0%(GC), 1,1'-Bicyclo(1,1,1)pentane-1,3-dicarboxylic acid. Offered by: Ambeed, Fluorochem, GLPBio, TCI, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 10g, 500g.
Bicyclo[1.1.1]pentane-1,3-dicarboxylic acid (CAS 56842-95-6) is a chemical compound with the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. IUPAC name: bicyclo[1.1.1]pentane-1,3-dicarboxylic acid. InChIKey: SBLRPOGZAJTJEG-UHFFFAOYSA-N.
| Molecular formula | C7H8O4 |
|---|---|
| Molecular weight | 156.14 g/mol |
| IUPAC name | bicyclo[1.1.1]pentane-1,3-dicarboxylic acid |
| InChIKey | SBLRPOGZAJTJEG-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)