Products 868277-47-8

CAS 868277-47-8 is the registry number for 2-(Furan-2-ylmethoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(furan-2-ylmethoxy)acetic acid (CAS 868277-47-8) is a chemical compound with the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. IUPAC name: 2-(furan-2-ylmethoxy)acetic acid. InChIKey: PDLBGOHATIRQBG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O4
Molecular weight156.14 g/mol
IUPAC name2-(furan-2-ylmethoxy)acetic acid
InChIKeyPDLBGOHATIRQBG-UHFFFAOYSA-N
SMILESC1=COC(=C1)COCC(=O)O

Computed by PubChem (NCBI)