CAS 1343233-44-2 appears in our catalog under these names: 5,8-Dichloroquinolin-2-amine, 5,8-Dichloroquinolin-2-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
5,8-dichloroquinolin-2-amine (CAS 1343233-44-2) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 5,8-dichloroquinolin-2-amine. InChIKey: KQUJYLDKMMCLPE-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 5,8-dichloroquinolin-2-amine |
| InChIKey | KQUJYLDKMMCLPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C(C=CC(=C21)Cl)Cl)N |
Computed by PubChem (NCBI)