CAS 13433-10-8 appears in our catalog under these names: N4-((S)-1-Carboxy-2-phenylethyl)-L-asparagine, H–Asp(Phe–OH)–OH, β-Asp-Phe. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 500mg, 1g, 250mg, Get quote.
(2S)-2-amino-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid (CAS 13433-10-8) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: (2S)-2-amino-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid. InChIKey: KDGAYJIGGCDHPH-UWVGGRQHSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (2S)-2-amino-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobutanoic acid |
| InChIKey | KDGAYJIGGCDHPH-UWVGGRQHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)