CAS 1343894-50-7 appears in our catalog under these names: 2-(3,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl)acetic acid, 2-(3,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl)acetic acid, 98%, 98%, 2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)-1h-pyrazol-4-yl]acetic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g, 5g.
2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetic acid (CAS 1343894-50-7) is a chemical compound with the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. IUPAC name: 2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetic acid. InChIKey: UCFGWZYLWDZPDR-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2 |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | 2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetic acid |
| InChIKey | UCFGWZYLWDZPDR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(F)(F)F)C)CC(=O)O |
Computed by PubChem (NCBI)