CAS 13440-24-9 appears in our catalog under these names: Meso-1,2-dibromo-1,2-diphenylethane, 97%, meso–1,2–Dibromo–1,2–diphenylethane, meso-1,2-Dibromo-1,2-diphenylethane, 97% , meso-1,2-Dibromo-1,2-diphenylethane, >97.0%(T), MESO-1,2-DIBROMO-1,2-DIPHENYLETHANE, >=&. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich. Available pack sizes: 5g, 25g, 1g, 100G.
(1,2-dibromo-2-phenylethyl)benzene (CAS 13440-24-9) is a chemical compound with the molecular formula C14H12Br2 and a molecular weight of 340.05 g/mol. IUPAC name: (1,2-dibromo-2-phenylethyl)benzene. InChIKey: GKESIQQTGWVOLH-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2 |
|---|---|
| Molecular weight | 340.05 g/mol |
| IUPAC name | (1,2-dibromo-2-phenylethyl)benzene |
| InChIKey | GKESIQQTGWVOLH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C2=CC=CC=C2)Br)Br |
Computed by PubChem (NCBI)