Products 2586126-69-2
CAS 2586126-69-2 appears in our catalog under these names: 1,3-Dibromo-5-(4-methylbenzyl)benzene, 95%, 1,3-Dibromo-5-(4-methylbenzyl)benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
1,3-dibromo-5-[(4-methylphenyl)methyl]benzene (CAS 2586126-69-2) is a chemical compound with the molecular formula C14H12Br2 and a molecular weight of 340.05 g/mol. IUPAC name: 1,3-dibromo-5-[(4-methylphenyl)methyl]benzene. InChIKey: CTUXOWQLPPTOMJ-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2 |
|---|---|
| Molecular weight | 340.05 g/mol |
| IUPAC name | 1,3-dibromo-5-[(4-methylphenyl)methyl]benzene |
| InChIKey | CTUXOWQLPPTOMJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)