Products 5789-30-0
CAS 5789-30-0 is the registry number for 1,2-Dibromo-1,2-diphenylethane, 96%. Offered by: Thermo Scientific (Acros). Available pack sizes: 5g, 25g.
(1,2-dibromo-2-phenylethyl)benzene (CAS 5789-30-0) is a chemical compound with the molecular formula C14H12Br2 and a molecular weight of 340.05 g/mol. IUPAC name: (1,2-dibromo-2-phenylethyl)benzene. InChIKey: GKESIQQTGWVOLH-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2 |
|---|---|
| Molecular weight | 340.05 g/mol |
| IUPAC name | (1,2-dibromo-2-phenylethyl)benzene |
| InChIKey | GKESIQQTGWVOLH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C2=CC=CC=C2)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
1,2-Dibromo-1,2-diphenylethane, meso-Dibromostilbene, alpha,alpha-Dibromobibenzyl, Benzene, 1,1'-(1,2-dibromo-1,2-ethanediyl)bis-, Bibenzyl, alpha,alpha'-dibromo-, Benzene, 1,1'-(1,2-dibromo-1,2-ethanediyl)bis-, (R*,S*)-, Stilbene dibromide, (1,2-Dibromo-2-phenylethyl)benzene, (1,2-Dibromo-2-phenyl-ethyl)benzene, Bibenzyl,.alpha.'-dibromo-