CAS 31458-17-0 is the registry number for 4,4'-Dibromo-2,2'-dimethyl-1,1'-biphenyl, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-1-(4-bromo-2-methylphenyl)-2-methylbenzene (CAS 31458-17-0) is a chemical compound with the molecular formula C14H12Br2 and a molecular weight of 340.05 g/mol. IUPAC name: 4-bromo-1-(4-bromo-2-methylphenyl)-2-methylbenzene. InChIKey: HEGPQHVSIHVFIP-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2 |
|---|---|
| Molecular weight | 340.05 g/mol |
| IUPAC name | 4-bromo-1-(4-bromo-2-methylphenyl)-2-methylbenzene |
| InChIKey | HEGPQHVSIHVFIP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C2=C(C=C(C=C2)Br)C |
Computed by PubChem (NCBI)