Products 1344205-16-8
CAS 1344205-16-8 is the registry number for tert-Butyl 5-chlorothiophene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 5-chlorothiophene-2-carboxylate (CAS 1344205-16-8) is a chemical compound with the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. IUPAC name: tert-butyl 5-chlorothiophene-2-carboxylate. InChIKey: HZJZSNMVKHBRTE-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO2S |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | tert-butyl 5-chlorothiophene-2-carboxylate |
| InChIKey | HZJZSNMVKHBRTE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(S1)Cl |
Computed by PubChem (NCBI)