CAS 71530-58-0 appears in our catalog under these names: 3-Isopropylbenzene-1-sulfonyl chloride, 3-Isopropylbenzene-1-sulfonyl chloride 95%, 3-Isopropylbenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 2.5g, 10g.
3-propan-2-ylbenzenesulfonyl chloride (CAS 71530-58-0) is a chemical compound with the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. IUPAC name: 3-propan-2-ylbenzenesulfonyl chloride. InChIKey: ZFVRVVPYKFLHAE-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO2S |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 3-propan-2-ylbenzenesulfonyl chloride |
| InChIKey | ZFVRVVPYKFLHAE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)