CAS 22381-53-9 is the registry number for 2-Chloroethyl p-tolyl sulfone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2-chloroethylsulfonyl)-4-methylbenzene (CAS 22381-53-9) is a chemical compound with the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. IUPAC name: 1-(2-chloroethylsulfonyl)-4-methylbenzene. InChIKey: KUAGAJLNIOIGRN-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO2S |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 1-(2-chloroethylsulfonyl)-4-methylbenzene |
| InChIKey | KUAGAJLNIOIGRN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CCCl |
Computed by PubChem (NCBI)