CAS 92890-80-7 is the registry number for 2,4,5-Trimethylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2,4,5-trimethylbenzenesulfonyl chloride (CAS 92890-80-7) is a chemical compound with the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. IUPAC name: 2,4,5-trimethylbenzenesulfonyl chloride. InChIKey: ZFMHIKFWALHYFF-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO2S |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 2,4,5-trimethylbenzenesulfonyl chloride |
| InChIKey | ZFMHIKFWALHYFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)