Products 1344267-99-7
CAS 1344267-99-7 is the registry number for 5-((4-Chlorophenyl)methyl)-1,2,4-oxadiazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-[(4-chlorophenyl)methyl]-1,2,4-oxadiazole-3-carboxylic acid (CAS 1344267-99-7) is a chemical compound with the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. IUPAC name: 5-[(4-chlorophenyl)methyl]-1,2,4-oxadiazole-3-carboxylic acid. InChIKey: WLEWSFMVIDEHQG-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O3 |
|---|---|
| Molecular weight | 238.63 g/mol |
| IUPAC name | 5-[(4-chlorophenyl)methyl]-1,2,4-oxadiazole-3-carboxylic acid |
| InChIKey | WLEWSFMVIDEHQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NC(=NO2)C(=O)O)Cl |
Computed by PubChem (NCBI)