CAS 1344296-01-0 appears in our catalog under these names: 1-Ethyl-2-methyl-1h-imidazole-4-sulfonyl chloride, 95%, 1-Ethyl-2-methyl-1H-imidazole-4-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 50mg, 0,5g.
1-ethyl-2-methylimidazole-4-sulfonyl chloride (CAS 1344296-01-0) is a chemical compound with the molecular formula C6H9ClN2O2S and a molecular weight of 208.67 g/mol. IUPAC name: 1-ethyl-2-methylimidazole-4-sulfonyl chloride. InChIKey: WNURJTMTIFTQOB-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O2S |
|---|---|
| Molecular weight | 208.67 g/mol |
| IUPAC name | 1-ethyl-2-methylimidazole-4-sulfonyl chloride |
| InChIKey | WNURJTMTIFTQOB-UHFFFAOYSA-N |
| SMILES | CCN1C=C(N=C1C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)