CAS 1427380-54-8 appears in our catalog under these names: 2-Methanesulfonylpyridin-4-amine hydrochloride, 95%, 2-(Methylsulfonyl)pyridin-4-amine hydrochloride, 95%, 2-Methanesulfonylpyridin-4-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-methylsulfonylpyridin-4-amine;hydrochloride (CAS 1427380-54-8) is a chemical compound with the molecular formula C6H9ClN2O2S and a molecular weight of 208.67 g/mol. IUPAC name: 2-methylsulfonylpyridin-4-amine;hydrochloride. InChIKey: BOLUXGZIDYUGPP-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O2S |
|---|---|
| Molecular weight | 208.67 g/mol |
| IUPAC name | 2-methylsulfonylpyridin-4-amine;hydrochloride |
| InChIKey | BOLUXGZIDYUGPP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=CC(=C1)N.Cl |
Computed by PubChem (NCBI)