CAS 6101-31-1 appears in our catalog under these names: 4-Aminobenzenesulphonamide hydrochloride, 95%, 4-Aminobenzenesulfonamide hydrochloride 98%, 4-Aminobenzenesulfonamide Hydrochloride, 98%, 98%, 4-AMINOBENZENESULPHONAMIDE HCL, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g.
4-aminobenzenesulfonamide;hydrochloride (CAS 6101-31-1) is a chemical compound with the molecular formula C6H9ClN2O2S and a molecular weight of 208.67 g/mol. IUPAC name: 4-aminobenzenesulfonamide;hydrochloride. InChIKey: XZMIAZCXISFPEJ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O2S |
|---|---|
| Molecular weight | 208.67 g/mol |
| IUPAC name | 4-aminobenzenesulfonamide;hydrochloride |
| InChIKey | XZMIAZCXISFPEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)