CAS 1881289-02-6 is the registry number for 2-chloro-N,N-dimethyl-1H-pyrrole-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N,N-dimethylpyrrole-1-sulfonamide (CAS 1881289-02-6) is a chemical compound with the molecular formula C6H9ClN2O2S and a molecular weight of 208.67 g/mol. IUPAC name: 2-chloro-N,N-dimethylpyrrole-1-sulfonamide. InChIKey: YTDZZKPNGXILSN-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O2S |
|---|---|
| Molecular weight | 208.67 g/mol |
| IUPAC name | 2-chloro-N,N-dimethylpyrrole-1-sulfonamide |
| InChIKey | YTDZZKPNGXILSN-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C=CC=C1Cl |
Computed by PubChem (NCBI)