CAS 1344503-71-4 is the registry number for (R)-(2-(1-aminoethyl)phenyl)(3-fluorophenyl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-[(1R)-1-aminoethyl]phenyl]-(3-fluorophenyl)methanone (CAS 1344503-71-4) is a chemical compound with the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. IUPAC name: [2-[(1R)-1-aminoethyl]phenyl]-(3-fluorophenyl)methanone. InChIKey: JIBMIOIDQARPOA-SNVBAGLBSA-N.
| Molecular formula | C15H14FNO |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | [2-[(1R)-1-aminoethyl]phenyl]-(3-fluorophenyl)methanone |
| InChIKey | JIBMIOIDQARPOA-SNVBAGLBSA-N |
| SMILES | C[C@H](C1=CC=CC=C1C(=O)C2=CC(=CC=C2)F)N |
Computed by PubChem (NCBI)