CAS 87657-78-1 appears in our catalog under these names: Flurbiprofen Impurity 58, Flurbiprofen Impurity 15, 2–(2–fluoro–(1,1'–biphenyl)–4–yl)propanamide, 2-Fluoro-α-methyl[1,1'-biphenyl]-4-acetamide. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 100mg, 25mg, 50mg, 1g.
2-(3-fluoro-4-phenylphenyl)propanamide (CAS 87657-78-1) is a chemical compound with the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. IUPAC name: 2-(3-fluoro-4-phenylphenyl)propanamide. InChIKey: MRGROCIVLXFMNN-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 2-(3-fluoro-4-phenylphenyl)propanamide |
| InChIKey | MRGROCIVLXFMNN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)N |
Computed by PubChem (NCBI)