Products 937598-03-3
CAS 937598-03-3 is the registry number for 4-(2,3-Dihydro-1H-inden-5-yloxy)-3-fluorophenylamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,3-dihydro-1H-inden-5-yloxy)-3-fluoroaniline (CAS 937598-03-3) is a chemical compound with the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. IUPAC name: 4-(2,3-dihydro-1H-inden-5-yloxy)-3-fluoroaniline. InChIKey: PIHCGIADQZLTNX-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 4-(2,3-dihydro-1H-inden-5-yloxy)-3-fluoroaniline |
| InChIKey | PIHCGIADQZLTNX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)OC3=C(C=C(C=C3)N)F |
Computed by PubChem (NCBI)