CAS 332168-85-1 is the registry number for 2-Fluoro-n-(3,5-dimethylphenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(3,5-dimethylphenyl)-2-fluorobenzamide (CAS 332168-85-1) is a chemical compound with the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. IUPAC name: N-(3,5-dimethylphenyl)-2-fluorobenzamide. InChIKey: GKEBWXLAFINVJG-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | N-(3,5-dimethylphenyl)-2-fluorobenzamide |
| InChIKey | GKEBWXLAFINVJG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)C2=CC=CC=C2F)C |
Computed by PubChem (NCBI)